C19H16N4O8S — CID 41205108
methyl 2-[2-(3,5-dinitrobenzoyl)imino-4-ethoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 41205108) has the molecular formula C19H16N4O8S and a molecular weight of 460.42 g/mol. Its IUPAC name is methyl 2-[2-(3,5-dinitrobenzoyl)imino-4-ethoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(3,5-dinitrobenzoyl)imino-4-ethoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41205108 |
| Molecular Formula | C19H16N4O8S |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | methyl 2-[2-(3,5-dinitrobenzoyl)imino-4-ethoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOc1cccc2s/c(=N\C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)n(CC(=O)OC)c12 |
| InChI | InChI=1S/C19H16N4O8S/c1-3-31-14-5-4-6-15-17(14)21(10-16(24)30-2)19(32-15)20-18(25)11-7-12(22(26)27)9-13(8-11)23(28)29/h4-9H,3,10H2,1-2H3/b20-19- |
| InChIKey | FDXOFBZMACZVJK-VXPUYCOJSA-N |
| XLogP | 2.83 |
| TPSA | 156.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|