C17H11FN4O7S — CID 5169117
methyl 2-[2-(3,5-dinitrobenzoyl)imino-4-fluoro-1,3-benzothiazol-3-yl]acetate (PubChem CID 5169117) has the molecular formula C17H11FN4O7S and a molecular weight of 434.36 g/mol. Its IUPAC name is methyl 2-[2-(3,5-dinitrobenzoyl)imino-4-fluoro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(3,5-dinitrobenzoyl)imino-4-fluoro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 5169117 |
| Molecular Formula | C17H11FN4O7S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | methyl 2-[2-(3,5-dinitrobenzoyl)imino-4-fluoro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc2cccc(F)c21 |
| InChI | InChI=1S/C17H11FN4O7S/c1-29-14(23)8-20-15-12(18)3-2-4-13(15)30-17(20)19-16(24)9-5-10(21(25)26)7-11(6-9)22(27)28/h2-7H,8H2,1H3/b19-17- |
| InChIKey | LCMWEMKSADQSAA-ZPHPHTNESA-N |
| XLogP | 2.57 |
| TPSA | 146.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|