C18H14N4O9S2 — CID 5076207
methyl 2-[2-(3,5-dinitrobenzoyl)imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 5076207) has the molecular formula C18H14N4O9S2 and a molecular weight of 494.46 g/mol. Its IUPAC name is methyl 2-[2-(3,5-dinitrobenzoyl)imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(3,5-dinitrobenzoyl)imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 5076207 |
| Molecular Formula | C18H14N4O9S2 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | methyl 2-[2-(3,5-dinitrobenzoyl)imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H14N4O9S2/c1-31-16(23)9-20-14-4-3-13(33(2,29)30)8-15(14)32-18(20)19-17(24)10-5-11(21(25)26)7-12(6-10)22(27)28/h3-8H,9H2,1-2H3/b19-18- |
| InChIKey | UBNCEGSVZDIOSP-HNENSFHCSA-N |
| XLogP | 1.84 |
| TPSA | 181.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|