C19H15N3O7S — CID 3670469
methyl 4-[[3-(2-methoxy-2-oxoethyl)-6-nitro-1,3-benzothiazol-2-ylidene]carbamoyl]benzoate (PubChem CID 3670469) has the molecular formula C19H15N3O7S and a molecular weight of 429.41 g/mol. Its IUPAC name is methyl 4-[[3-(2-methoxy-2-oxoethyl)-6-nitro-1,3-benzothiazol-2-ylidene]carbamoyl]benzoate.
| Compound Name | methyl 4-[[3-(2-methoxy-2-oxoethyl)-6-nitro-1,3-benzothiazol-2-ylidene]carbamoyl]benzoate |
|---|---|
| PubChem CID | 3670469 |
| Molecular Formula | C19H15N3O7S |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | methyl 4-[[3-(2-methoxy-2-oxoethyl)-6-nitro-1,3-benzothiazol-2-ylidene]carbamoyl]benzoate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc(C(=O)OC)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C19H15N3O7S/c1-28-16(23)10-21-14-8-7-13(22(26)27)9-15(14)30-19(21)20-17(24)11-3-5-12(6-4-11)18(25)29-2/h3-9H,10H2,1-2H3/b20-19- |
| InChIKey | HANCXFACQXTJNJ-VXPUYCOJSA-N |
| XLogP | 2.31 |
| TPSA | 130.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|