C17H12FN3O5S — CID 4188390
methyl 2-[6-fluoro-2-(4-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 4188390) has the molecular formula C17H12FN3O5S and a molecular weight of 389.36 g/mol. Its IUPAC name is methyl 2-[6-fluoro-2-(4-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[6-fluoro-2-(4-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4188390 |
| Molecular Formula | C17H12FN3O5S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | methyl 2-[6-fluoro-2-(4-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C17H12FN3O5S/c1-26-15(22)9-20-13-7-4-11(18)8-14(13)27-17(20)19-16(23)10-2-5-12(6-3-10)21(24)25/h2-8H,9H2,1H3/b19-17- |
| InChIKey | YMUOBVALCAXWFD-ZPHPHTNESA-N |
| XLogP | 2.66 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|