C20H16N4O9S — CID 4073002
methyl 2-(3,5-dinitrobenzoyl)imino-3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 4073002) has the molecular formula C20H16N4O9S and a molecular weight of 488.43 g/mol. Its IUPAC name is methyl 2-(3,5-dinitrobenzoyl)imino-3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(3,5-dinitrobenzoyl)imino-3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4073002 |
| Molecular Formula | C20H16N4O9S |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | methyl 2-(3,5-dinitrobenzoyl)imino-3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C20H16N4O9S/c1-3-33-17(25)10-22-15-5-4-11(19(27)32-2)8-16(15)34-20(22)21-18(26)12-6-13(23(28)29)9-14(7-12)24(30)31/h4-9H,3,10H2,1-2H3/b21-20- |
| InChIKey | OZXBQRZMOJLRNB-MRCUWXFGSA-N |
| XLogP | 2.61 |
| TPSA | 173.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|