C17H11Cl2N3O5S — CID 4999888
methyl 2-[2-(2,4-dichlorobenzoyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 4999888) has the molecular formula C17H11Cl2N3O5S and a molecular weight of 440.26 g/mol. Its IUPAC name is methyl 2-[2-(2,4-dichlorobenzoyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(2,4-dichlorobenzoyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4999888 |
| Molecular Formula | C17H11Cl2N3O5S |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | methyl 2-[2-(2,4-dichlorobenzoyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc(Cl)cc2Cl)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H11Cl2N3O5S/c1-27-15(23)8-21-13-5-3-10(22(25)26)7-14(13)28-17(21)20-16(24)11-4-2-9(18)6-12(11)19/h2-7H,8H2,1H3/b20-17- |
| InChIKey | JYSUKEXNARIJAH-JZJYNLBNSA-N |
| XLogP | 3.83 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|