C17H13Cl2N3O3S — CID 43984974
2,4-dichloro-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43984974) has the molecular formula C17H13Cl2N3O3S and a molecular weight of 410.28 g/mol. Its IUPAC name is 2,4-dichloro-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2,4-dichloro-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43984974 |
| Molecular Formula | C17H13Cl2N3O3S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 2,4-dichloro-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | CCCn1/c(=N/C(=O)c2ccc(Cl)cc2Cl)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H13Cl2N3O3S/c1-2-7-21-14-6-4-11(22(24)25)9-15(14)26-17(21)20-16(23)12-5-3-10(18)8-13(12)19/h3-6,8-9H,2,7H2,1H3/b20-17- |
| InChIKey | WKZASZMCPOPRHX-JZJYNLBNSA-N |
| XLogP | 5.07 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|