C12H13N3O3S — CID 7540732
N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 7540732) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 7540732 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | CCCn1/c(=N/C(C)=O)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H13N3O3S/c1-3-6-14-10-5-4-9(15(17)18)7-11(10)19-12(14)13-8(2)16/h4-5,7H,3,6H2,1-2H3/b13-12- |
| InChIKey | HVALVKQRBYFYBI-SEYXRHQNSA-N |
| XLogP | 2.47 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|