C20H16N4O5S — CID 43985003
2-(1,3-dioxoisoindol-2-yl)-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 43985003) has the molecular formula C20H16N4O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 43985003 |
| Molecular Formula | C20H16N4O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | CCCn1/c(=N/C(=O)CN2C(=O)c3ccccc3C2=O)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H16N4O5S/c1-2-9-22-15-8-7-12(24(28)29)10-16(15)30-20(22)21-17(25)11-23-18(26)13-5-3-4-6-14(13)19(23)27/h3-8,10H,2,9,11H2,1H3/b21-20- |
| InChIKey | DQBNDQZJBGKUSL-MRCUWXFGSA-N |
| XLogP | 2.74 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|