C22H20N4O7S2 — CID 43983668
ethyl 3-[2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate (PubChem CID 43983668) has the molecular formula C22H20N4O7S2 and a molecular weight of 516.56 g/mol. Its IUPAC name is ethyl 3-[2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate.
| Compound Name | ethyl 3-[2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 43983668 |
| Molecular Formula | C22H20N4O7S2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | ethyl 3-[2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate |
| SMILES | CCOC(=O)CCn1/c(=N/C(=O)CN2C(=O)c3ccccc3C2=O)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C22H20N4O7S2/c1-2-33-19(28)9-10-25-16-8-7-13(35(23,31)32)11-17(16)34-22(25)24-18(27)12-26-20(29)14-5-3-4-6-15(14)21(26)30/h3-8,11H,2,9-10,12H2,1H3,(H2,23,31,32)/b24-22- |
| InChIKey | NVRIMVIJQDGLSP-GYHWCHFESA-N |
| XLogP | 1.03 |
| TPSA | 158.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|