C21H23N3O7S2 — CID 43983560
ethyl 3-[2-(3,5-dimethoxybenzoyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate (PubChem CID 43983560) has the molecular formula C21H23N3O7S2 and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl 3-[2-(3,5-dimethoxybenzoyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate.
| Compound Name | ethyl 3-[2-(3,5-dimethoxybenzoyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 43983560 |
| Molecular Formula | C21H23N3O7S2 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | ethyl 3-[2-(3,5-dimethoxybenzoyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]propanoate |
| SMILES | CCOC(=O)CCn1/c(=N/C(=O)c2cc(OC)cc(OC)c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H23N3O7S2/c1-4-31-19(25)7-8-24-17-6-5-16(33(22,27)28)12-18(17)32-21(24)23-20(26)13-9-14(29-2)11-15(10-13)30-3/h5-6,9-12H,4,7-8H2,1-3H3,(H2,22,27,28)/b23-21- |
| InChIKey | ZFONAXYJFDZZIY-LNVKXUELSA-N |
| XLogP | 2.06 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |