C19H19N3O6S2 — CID 4671221
ethyl 2-[2-(3-methoxybenzoyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 4671221) has the molecular formula C19H19N3O6S2 and a molecular weight of 449.51 g/mol. Its IUPAC name is ethyl 2-[2-(3-methoxybenzoyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(3-methoxybenzoyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4671221 |
| Molecular Formula | C19H19N3O6S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | ethyl 2-[2-(3-methoxybenzoyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cccc(OC)c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H19N3O6S2/c1-3-28-17(23)11-22-15-8-7-14(30(20,25)26)10-16(15)29-19(22)21-18(24)12-5-4-6-13(9-12)27-2/h4-10H,3,11H2,1-2H3,(H2,20,25,26)/b21-19- |
| InChIKey | AIKDHWGZRPBVHD-VZCXRCSSSA-N |
| XLogP | 1.66 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |