C16H16N4O6S — CID 5102839
2-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]acetamide (PubChem CID 5102839) has the molecular formula C16H16N4O6S and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]acetamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 5102839 |
| Molecular Formula | C16H16N4O6S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]acetamide |
| SMILES | COCCn1/c(=N/C(=O)CN2C(=O)CCC2=O)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H16N4O6S/c1-26-7-6-18-11-3-2-10(20(24)25)8-12(11)27-16(18)17-13(21)9-19-14(22)4-5-15(19)23/h2-3,8H,4-7,9H2,1H3/b17-16- |
| InChIKey | IPFUTHIWAKGQPI-MSUUIHNZSA-N |
| XLogP | 0.83 |
| TPSA | 124.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|