C14H17N3O4S — CID 5223544
N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-2-methylpropanamide (PubChem CID 5223544) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-2-methylpropanamide.
| Compound Name | N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-2-methylpropanamide |
|---|---|
| PubChem CID | 5223544 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-2-methylpropanamide |
| SMILES | COCCn1/c(=N/C(=O)C(C)C)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H17N3O4S/c1-9(2)13(18)15-14-16(6-7-21-3)11-5-4-10(17(19)20)8-12(11)22-14/h4-5,8-9H,6-7H2,1-3H3/b15-14- |
| InChIKey | ZWKKIQPTIJNYRR-PFONDFGASA-N |
| XLogP | 2.34 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|