C20H14N4O7S — CID 4995586
methyl 2-[2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 4995586) has the molecular formula C20H14N4O7S and a molecular weight of 454.42 g/mol. Its IUPAC name is methyl 2-[2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4995586 |
| Molecular Formula | C20H14N4O7S |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | methyl 2-[2-[2-(1,3-dioxoisoindol-2-yl)acetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CN2C(=O)c3ccccc3C2=O)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H14N4O7S/c1-31-17(26)10-22-14-7-6-11(24(29)30)8-15(14)32-20(22)21-16(25)9-23-18(27)12-4-2-3-5-13(12)19(23)28/h2-8H,9-10H2,1H3/b21-20- |
| InChIKey | UWUYJOURRDPMRX-MRCUWXFGSA-N |
| XLogP | 1.51 |
| TPSA | 141.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|