C18H16N4O7S2 — CID 43985159
N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide (PubChem CID 43985159) has the molecular formula C18H16N4O7S2 and a molecular weight of 464.48 g/mol. Its IUPAC name is N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide.
| Compound Name | N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 43985159 |
| Molecular Formula | C18H16N4O7S2 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
| SMILES | CCCn1/c(=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H16N4O7S2/c1-3-6-20-15-5-4-14(31(2,28)29)10-16(15)30-18(20)19-17(23)11-7-12(21(24)25)9-13(8-11)22(26)27/h4-5,7-10H,3,6H2,1-2H3/b19-18- |
| InChIKey | WGQANTCIXXXHJD-HNENSFHCSA-N |
| XLogP | 3.07 |
| TPSA | 154.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|