C17H13BrN4O5S — CID 43984817
N-(6-bromo-3-propyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide (PubChem CID 43984817) has the molecular formula C17H13BrN4O5S and a molecular weight of 465.29 g/mol. Its IUPAC name is N-(6-bromo-3-propyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide.
| Compound Name | N-(6-bromo-3-propyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 43984817 |
| Molecular Formula | C17H13BrN4O5S |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | N-(6-bromo-3-propyl-1,3-benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
| SMILES | CCCn1/c(=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C17H13BrN4O5S/c1-2-5-20-14-4-3-11(18)8-15(14)28-17(20)19-16(23)10-6-12(21(24)25)9-13(7-10)22(26)27/h3-4,6-9H,2,5H2,1H3/b19-17- |
| InChIKey | WUKXGMQYYVRJFB-ZPHPHTNESA-N |
| XLogP | 4.43 |
| TPSA | 120.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|