C18H14N4O3S2 — CID 43985054
N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide (PubChem CID 43985054) has the molecular formula C18H14N4O3S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 43985054 |
| Molecular Formula | C18H14N4O3S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)-1,3-benzothiazole-6-carboxamide |
| SMILES | CCCn1/c(=N/C(=O)c2ccc3ncsc3c2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H14N4O3S2/c1-2-7-21-14-6-4-12(22(24)25)9-16(14)27-18(21)20-17(23)11-3-5-13-15(8-11)26-10-19-13/h3-6,8-10H,2,7H2,1H3/b20-18- |
| InChIKey | PQKHTEFWHQDWFU-ZZEZOPTASA-N |
| XLogP | 4.37 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|