C19H19N3O4S — CID 43984449
N-(6-ethoxy-3-propyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide (PubChem CID 43984449) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-(6-ethoxy-3-propyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide.
| Compound Name | N-(6-ethoxy-3-propyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide |
|---|---|
| PubChem CID | 43984449 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(6-ethoxy-3-propyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide |
| SMILES | CCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C19H19N3O4S/c1-3-11-21-16-10-9-15(26-4-2)12-17(16)27-19(21)20-18(23)13-5-7-14(8-6-13)22(24)25/h5-10,12H,3-4,11H2,1-2H3/b20-19- |
| InChIKey | IZKDTRRIUHQXNO-VXPUYCOJSA-N |
| XLogP | 4.16 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|