C20H19N3O5S2 — CID 74909125
N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 74909125) has the molecular formula C20H19N3O5S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74909125 |
| Molecular Formula | C20H19N3O5S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCCn1/c(=N/C(=O)C=Cc2ccc([N+](=O)[O-])cc2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H19N3O5S2/c1-3-12-22-17-10-9-16(30(2,27)28)13-18(17)29-20(22)21-19(24)11-6-14-4-7-15(8-5-14)23(25)26/h4-11,13H,3,12H2,1-2H3/b11-6?,21-20- |
| InChIKey | QUZFCUUUBKDUEG-ZGUQOTJCSA-N |
| XLogP | 3.57 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|