C18H17N3O6S3 — CID 3505818
N-[3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 3505818) has the molecular formula C18H17N3O6S3 and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | N-[3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3505818 |
| Molecular Formula | C18H17N3O6S3 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | N-[3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | COCCn1/c(=N/C(=O)C=Cc2ccc([N+](=O)[O-])s2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H17N3O6S3/c1-27-10-9-20-14-6-5-13(30(2,25)26)11-15(14)29-18(20)19-16(22)7-3-12-4-8-17(28-12)21(23)24/h3-8,11H,9-10H2,1-2H3/b7-3?,19-18- |
| InChIKey | UMOJSEREUKVGBT-MRQVZSDZSA-N |
| XLogP | 2.86 |
| TPSA | 120.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|