C17H14N4O7S3 — CID 43939592
methyl 2-[2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 43939592) has the molecular formula C17H14N4O7S3 and a molecular weight of 482.52 g/mol. Its IUPAC name is methyl 2-[2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43939592 |
| Molecular Formula | C17H14N4O7S3 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | methyl 2-[2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)/C=C\c2ccc([N+](=O)[O-])s2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C17H14N4O7S3/c1-28-16(23)9-20-12-5-4-11(31(18,26)27)8-13(12)30-17(20)19-14(22)6-2-10-3-7-15(29-10)21(24)25/h2-8H,9H2,1H3,(H2,18,26,27)/b6-2-,19-17- |
| InChIKey | FGTBPPMNWHCDLU-TUSVJKFCSA-N |
| XLogP | 1.63 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|