C15H12N4O8S2 — CID 3686298
methyl 2-[2-(5-nitrofuran-2-carbonyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 3686298) has the molecular formula C15H12N4O8S2 and a molecular weight of 440.42 g/mol. Its IUPAC name is methyl 2-[2-(5-nitrofuran-2-carbonyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(5-nitrofuran-2-carbonyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 3686298 |
| Molecular Formula | C15H12N4O8S2 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | methyl 2-[2-(5-nitrofuran-2-carbonyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc([N+](=O)[O-])o2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C15H12N4O8S2/c1-26-13(20)7-18-9-3-2-8(29(16,24)25)6-11(9)28-15(18)17-14(21)10-4-5-12(27-10)19(22)23/h2-6H,7H2,1H3,(H2,16,24,25)/b17-15- |
| InChIKey | ISRXPTMWACHKTC-ICFOKQHNSA-N |
| XLogP | 0.77 |
| TPSA | 177.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|