C20H19N3O6S2 — CID 40927835
ethyl 2-[6-ethoxy-2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 40927835) has the molecular formula C20H19N3O6S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is ethyl 2-[6-ethoxy-2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-ethoxy-2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 40927835 |
| Molecular Formula | C20H19N3O6S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | ethyl 2-[6-ethoxy-2-[(Z)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)/C=C\c2ccc([N+](=O)[O-])s2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C20H19N3O6S2/c1-3-28-13-5-8-15-16(11-13)31-20(22(15)12-19(25)29-4-2)21-17(24)9-6-14-7-10-18(30-14)23(26)27/h5-11H,3-4,12H2,1-2H3/b9-6-,21-20- |
| InChIKey | YBTUCEVOCISLRK-QQHLIWOHSA-N |
| XLogP | 3.78 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|