C19H18N2O4S2 — CID 5065600
ethyl 2-[6-methoxy-2-(3-thiophen-2-ylprop-2-enoylimino)-1,3-benzothiazol-3-yl]acetate (PubChem CID 5065600) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is ethyl 2-[6-methoxy-2-(3-thiophen-2-ylprop-2-enoylimino)-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-methoxy-2-(3-thiophen-2-ylprop-2-enoylimino)-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 5065600 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | ethyl 2-[6-methoxy-2-(3-thiophen-2-ylprop-2-enoylimino)-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)C=Cc2cccs2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C19H18N2O4S2/c1-3-25-18(23)12-21-15-8-6-13(24-2)11-16(15)27-19(21)20-17(22)9-7-14-5-4-10-26-14/h4-11H,3,12H2,1-2H3/b9-7?,20-19- |
| InChIKey | YXAMYYPBRZPJAZ-CYUGJMBCSA-N |
| XLogP | 3.48 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|