C18H15ClN2O3S2 — CID 78706665
ethyl 2-[4-chloro-2-(3-thiophen-2-ylprop-2-enoylimino)-1,3-benzothiazol-3-yl]acetate (PubChem CID 78706665) has the molecular formula C18H15ClN2O3S2 and a molecular weight of 406.92 g/mol. Its IUPAC name is ethyl 2-[4-chloro-2-(3-thiophen-2-ylprop-2-enoylimino)-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[4-chloro-2-(3-thiophen-2-ylprop-2-enoylimino)-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 78706665 |
| Molecular Formula | C18H15ClN2O3S2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | ethyl 2-[4-chloro-2-(3-thiophen-2-ylprop-2-enoylimino)-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)C=Cc2cccs2)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C18H15ClN2O3S2/c1-2-24-16(23)11-21-17-13(19)6-3-7-14(17)26-18(21)20-15(22)9-8-12-5-4-10-25-12/h3-10H,2,11H2,1H3/b9-8?,20-18- |
| InChIKey | WBFXUOKBXUKNQH-HPFXGEAESA-N |
| XLogP | 4.12 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|