C17H15FN2OS2 — CID 71962566
N-(4-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 71962566) has the molecular formula C17H15FN2OS2 and a molecular weight of 346.45 g/mol. Its IUPAC name is N-(4-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(4-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 71962566 |
| Molecular Formula | C17H15FN2OS2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-(4-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCCn1/c(=N/C(=O)C=Cc2cccs2)sc2cccc(F)c21 |
| InChI | InChI=1S/C17H15FN2OS2/c1-2-10-20-16-13(18)6-3-7-14(16)23-17(20)19-15(21)9-8-12-5-4-11-22-12/h3-9,11H,2,10H2,1H3/b9-8?,19-17- |
| InChIKey | XJIFMPOOPVLJDF-NKSJFOIBSA-N |
| XLogP | 4.45 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|