C18H16N2O3S2 — CID 40697371
(E)-N-(7-propyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 40697371) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (E)-N-(7-propyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(7-propyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 40697371 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (E)-N-(7-propyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCCn1/c(=N/C(=O)/C=C/c2cccs2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H16N2O3S2/c1-2-7-20-13-9-14-15(23-11-22-14)10-16(13)25-18(20)19-17(21)6-5-12-4-3-8-24-12/h3-6,8-10H,2,7,11H2,1H3/b6-5+,19-18- |
| InChIKey | DJUWGSGOWFZJJY-TYDAEBKASA-N |
| XLogP | 4.04 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|