C19H18N2OS2 — CID 74732289
N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 74732289) has the molecular formula C19H18N2OS2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 74732289 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | C=CCn1/c(=N/C(=O)C=Cc2cccs2)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C19H18N2OS2/c1-3-11-21-16-9-7-14(4-2)13-17(16)24-19(21)20-18(22)10-8-15-6-5-12-23-15/h3,5-10,12-13H,1,4,11H2,2H3/b10-8?,20-19- |
| InChIKey | KCXSNMRAYOMWSW-UCOZPZNQSA-N |
| XLogP | 4.65 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|