C17H15BrN2OS3 — CID 41124625
(E)-N-[6-bromo-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide (PubChem CID 41124625) has the molecular formula C17H15BrN2OS3 and a molecular weight of 439.43 g/mol. Its IUPAC name is (E)-N-[6-bromo-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[6-bromo-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 41124625 |
| Molecular Formula | C17H15BrN2OS3 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 437.95 |
| IUPAC Name | (E)-N-[6-bromo-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CSCCn1/c(=N/C(=O)/C=C/c2cccs2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C17H15BrN2OS3/c1-22-10-8-20-14-6-4-12(18)11-15(14)24-17(20)19-16(21)7-5-13-3-2-9-23-13/h2-7,9,11H,8,10H2,1H3/b7-5+,19-17- |
| InChIKey | MDKDJZGUOXZZLC-SWCJLUBCSA-N |
| XLogP | 5.03 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|