C18H17N3O2S2 — CID 5098572
N-(6-acetamido-3-ethyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 5098572) has the molecular formula C18H17N3O2S2 and a molecular weight of 371.49 g/mol. Its IUPAC name is N-(6-acetamido-3-ethyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(6-acetamido-3-ethyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 5098572 |
| Molecular Formula | C18H17N3O2S2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | N-(6-acetamido-3-ethyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCn1/c(=N/C(=O)C=Cc2cccs2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C18H17N3O2S2/c1-3-21-15-8-6-13(19-12(2)22)11-16(15)25-18(21)20-17(23)9-7-14-5-4-10-24-14/h4-11H,3H2,1-2H3,(H,19,22)/b9-7?,20-18- |
| InChIKey | VHKFICTTZKIVDX-YFPCBEKNSA-N |
| XLogP | 3.88 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|