C17H17N3O3S3 — CID 78499848
N-(3-propyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 78499848) has the molecular formula C17H17N3O3S3 and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(3-propyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(3-propyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 78499848 |
| Molecular Formula | C17H17N3O3S3 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-(3-propyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCCn1/c(=N/C(=O)C=Cc2cccs2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C17H17N3O3S3/c1-2-9-20-14-7-6-13(26(18,22)23)11-15(14)25-17(20)19-16(21)8-5-12-4-3-10-24-12/h3-8,10-11H,2,9H2,1H3,(H2,18,22,23)/b8-5?,19-17- |
| InChIKey | HXNBCJDUFZINJS-MBVJQAIJSA-N |
| XLogP | 2.96 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|