C20H16N2OS2 — CID 42387598
(E)-N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide (PubChem CID 42387598) has the molecular formula C20H16N2OS2 and a molecular weight of 364.50 g/mol. Its IUPAC name is (E)-N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 42387598 |
| Molecular Formula | C20H16N2OS2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (E)-N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCn1/c(=N/C(=O)/C=C/c2cccs2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C20H16N2OS2/c1-2-22-17-11-9-14-6-3-4-8-16(14)19(17)25-20(22)21-18(23)12-10-15-7-5-13-24-15/h3-13H,2H2,1H3/b12-10+,21-20- |
| InChIKey | OUBJIBHDFUBDBV-XRPJYHRESA-N |
| XLogP | 5.08 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|