C23H17ClN2OS — CID 43944135
(E)-3-(2-chlorophenyl)-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)prop-2-enamide (PubChem CID 43944135) has the molecular formula C23H17ClN2OS and a molecular weight of 404.92 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 43944135 |
| Molecular Formula | C23H17ClN2OS |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)prop-2-enamide |
| SMILES | C=CCn1/c(=N/C(=O)/C=C/c2ccccc2Cl)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C23H17ClN2OS/c1-2-15-26-20-13-11-16-7-3-5-9-18(16)22(20)28-23(26)25-21(27)14-12-17-8-4-6-10-19(17)24/h2-14H,1,15H2/b14-12+,25-23- |
| InChIKey | CMSRKJGQSVZTQA-QULUYXLPSA-N |
| XLogP | 5.84 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|