C21H15N3O3S — CID 4624489
N-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 4624489) has the molecular formula C21H15N3O3S and a molecular weight of 389.44 g/mol. Its IUPAC name is N-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4624489 |
| Molecular Formula | C21H15N3O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | Cn1/c(=N/C(=O)C=Cc2ccc([N+](=O)[O-])cc2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C21H15N3O3S/c1-23-18-12-9-15-4-2-3-5-17(15)20(18)28-21(23)22-19(25)13-8-14-6-10-16(11-7-14)24(26)27/h2-13H,1H3/b13-8?,22-21- |
| InChIKey | KEWFIDPWBCBMBD-SFNPTIIOSA-N |
| XLogP | 4.44 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|