C21H16N2OS — CID 7109194
(E)-N-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-phenylprop-2-enamide (PubChem CID 7109194) has the molecular formula C21H16N2OS and a molecular weight of 344.44 g/mol. Its IUPAC name is (E)-N-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 7109194 |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (E)-N-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
| SMILES | Cn1/c(=N/C(=O)/C=C/c2ccccc2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C21H16N2OS/c1-23-18-13-12-16-9-5-6-10-17(16)20(18)25-21(23)22-19(24)14-11-15-7-3-2-4-8-15/h2-14H,1H3/b14-11+,22-21- |
| InChIKey | FOYYMTMFKLLJIR-NNZLGEBMSA-N |
| XLogP | 4.53 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|