C18H16N2OS — CID 40613007
(E)-N-(3,4-dimethyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide (PubChem CID 40613007) has the molecular formula C18H16N2OS and a molecular weight of 308.41 g/mol. Its IUPAC name is (E)-N-(3,4-dimethyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3,4-dimethyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 40613007 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (E)-N-(3,4-dimethyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
| SMILES | Cc1cccc2s/c(=N\C(=O)/C=C/c3ccccc3)n(C)c12 |
| InChI | InChI=1S/C18H16N2OS/c1-13-7-6-10-15-17(13)20(2)18(22-15)19-16(21)12-11-14-8-4-3-5-9-14/h3-12H,1-2H3/b12-11+,19-18- |
| InChIKey | JKQQFBNQWXFZOO-VHLPMZHRSA-N |
| XLogP | 3.69 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|