C17H12F2N2OS — CID 40885580
(Z)-N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide (PubChem CID 40885580) has the molecular formula C17H12F2N2OS and a molecular weight of 330.36 g/mol. Its IUPAC name is (Z)-N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 40885580 |
| Molecular Formula | C17H12F2N2OS |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (Z)-N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
| SMILES | Cn1/c(=N/C(=O)/C=C\c2ccccc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C17H12F2N2OS/c1-21-16-13(19)9-12(18)10-14(16)23-17(21)20-15(22)8-7-11-5-3-2-4-6-11/h2-10H,1H3/b8-7-,20-17- |
| InChIKey | QHVHFVLLFBFTHG-URFNIMRFSA-N |
| XLogP | 3.66 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|