C19H13ClN2OS2 — CID 43943916
5-chloro-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)thiophene-2-carboxamide (PubChem CID 43943916) has the molecular formula C19H13ClN2OS2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 5-chloro-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 43943916 |
| Molecular Formula | C19H13ClN2OS2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 5-chloro-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)thiophene-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(Cl)s2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C19H13ClN2OS2/c1-2-11-22-14-8-7-12-5-3-4-6-13(12)17(14)25-19(22)21-18(23)15-9-10-16(20)24-15/h2-10H,1,11H2/b21-19- |
| InChIKey | NAVIEIFTNITDNC-VZCXRCSSSA-N |
| XLogP | 5.50 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|