C28H28N4O5S2 — CID 43944185
ethyl 4-[4-[(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)carbamoyl]phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 43944185) has the molecular formula C28H28N4O5S2 and a molecular weight of 564.69 g/mol. Its IUPAC name is ethyl 4-[4-[(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)carbamoyl]phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)carbamoyl]phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 43944185 |
| Molecular Formula | C28H28N4O5S2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | ethyl 4-[4-[(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)carbamoyl]phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCN(C(=O)OCC)CC3)cc2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C28H28N4O5S2/c1-3-15-32-24-14-11-20-7-5-6-8-23(20)25(24)38-27(32)29-26(33)21-9-12-22(13-10-21)39(35,36)31-18-16-30(17-19-31)28(34)37-4-2/h3,5-14H,1,4,15-19H2,2H3/b29-27- |
| InChIKey | ZENPRVLNDBXEQO-OHYPFYFLSA-N |
| XLogP | 4.25 |
| TPSA | 101.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|