C29H23N3O3S2 — CID 43944692
4-(2,3-dihydroindol-1-ylsulfonyl)-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)benzamide (PubChem CID 43944692) has the molecular formula C29H23N3O3S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43944692 |
| Molecular Formula | C29H23N3O3S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylsulfonyl)-N-(3-prop-2-enylbenzo[g][1,3]benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C29H23N3O3S2/c1-2-18-31-26-16-13-20-7-3-5-9-24(20)27(26)36-29(31)30-28(33)22-11-14-23(15-12-22)37(34,35)32-19-17-21-8-4-6-10-25(21)32/h2-16H,1,17-19H2/b30-29- |
| InChIKey | IOOPKXZOIFGUCE-FLWNBWAVSA-N |
| XLogP | 5.53 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|