C26H30N4O5S2 — CID 43978283
ethyl 4-[4-[(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)carbamoyl]phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 43978283) has the molecular formula C26H30N4O5S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is ethyl 4-[4-[(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)carbamoyl]phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)carbamoyl]phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 43978283 |
| Molecular Formula | C26H30N4O5S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | ethyl 4-[4-[(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)carbamoyl]phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCN(C(=O)OCC)CC3)cc2)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C26H30N4O5S2/c1-4-13-30-22-12-7-19(5-2)18-23(22)36-25(30)27-24(31)20-8-10-21(11-9-20)37(33,34)29-16-14-28(15-17-29)26(32)35-6-3/h4,7-12,18H,1,5-6,13-17H2,2-3H3/b27-25- |
| InChIKey | ALVXJDLKSTVYPS-RFBIWTDZSA-N |
| XLogP | 3.66 |
| TPSA | 101.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|