C24H27N3O3S2 — CID 4673301
4-(3-methylpiperidin-1-yl)sulfonyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4673301) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 4-(3-methylpiperidin-1-yl)sulfonyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(3-methylpiperidin-1-yl)sulfonyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4673301 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 4-(3-methylpiperidin-1-yl)sulfonyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCC(C)C3)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C24H27N3O3S2/c1-4-13-27-21-12-7-17(2)15-22(21)31-24(27)25-23(28)19-8-10-20(11-9-19)32(29,30)26-14-5-6-18(3)16-26/h4,7-12,15,18H,1,5-6,13-14,16H2,2-3H3/b25-24- |
| InChIKey | MWCQXBBXWBXPGD-IZHYLOQSSA-N |
| XLogP | 4.36 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|