C25H29N3O3S2 — CID 5081007
4-(2-ethylpiperidin-1-yl)sulfonyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 5081007) has the molecular formula C25H29N3O3S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 4-(2-ethylpiperidin-1-yl)sulfonyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(2-ethylpiperidin-1-yl)sulfonyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 5081007 |
| Molecular Formula | C25H29N3O3S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 4-(2-ethylpiperidin-1-yl)sulfonyl-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCCC3CC)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C25H29N3O3S2/c1-4-15-27-22-14-9-18(3)17-23(22)32-25(27)26-24(29)19-10-12-21(13-11-19)33(30,31)28-16-7-6-8-20(28)5-2/h4,9-14,17,20H,1,5-8,15-16H2,2-3H3/b26-25- |
| InChIKey | KMOKUSDOCRKHKX-QPLCGJKRSA-N |
| XLogP | 4.89 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|