C21H17ClN2OS2 — CID 43943998
3-chloro-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-benzothiophene-2-carboxamide (PubChem CID 43943998) has the molecular formula C21H17ClN2OS2 and a molecular weight of 412.97 g/mol. Its IUPAC name is 3-chloro-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43943998 |
| Molecular Formula | C21H17ClN2OS2 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 3-chloro-N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-benzothiophene-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2sc3ccccc3c2Cl)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C21H17ClN2OS2/c1-4-9-24-15-11-12(2)10-13(3)18(15)27-21(24)23-20(25)19-17(22)14-7-5-6-8-16(14)26-19/h4-8,10-11H,1,9H2,2-3H3/b23-21- |
| InChIKey | URLBQTXNOBPHRU-LNVKXUELSA-N |
| XLogP | 6.11 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|