C21H22N2OS — CID 43944695
N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,5-dimethylbenzamide (PubChem CID 43944695) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,5-dimethylbenzamide.
| Compound Name | N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 43944695 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,5-dimethylbenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(C)ccc2C)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C21H22N2OS/c1-6-9-23-18-12-14(3)10-16(5)19(18)25-21(23)22-20(24)17-11-13(2)7-8-15(17)4/h6-8,10-12H,1,9H2,2-5H3/b22-21- |
| InChIKey | RQFAZJFVUXBWLD-DQRAZIAOSA-N |
| XLogP | 4.86 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|