C21H22N2O3S — CID 16848931
N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,5-dimethoxybenzamide (PubChem CID 16848931) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,5-dimethoxybenzamide.
| Compound Name | N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 16848931 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(5,7-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,5-dimethoxybenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(OC)ccc2OC)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C21H22N2O3S/c1-6-9-23-17-11-13(2)10-14(3)19(17)27-21(23)22-20(24)16-12-15(25-4)7-8-18(16)26-5/h6-8,10-12H,1,9H2,2-5H3/b22-21- |
| InChIKey | MFFRYYRSGJRELS-DQRAZIAOSA-N |
| XLogP | 4.26 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|