C21H22N2O3S — CID 16912676
2-(2,4-dimethoxyphenyl)-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 16912676) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 16912676 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-(6-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2ccc(OC)cc2OC)sc2cc(C)ccc21 |
| InChI | InChI=1S/C21H22N2O3S/c1-5-10-23-17-9-6-14(2)11-19(17)27-21(23)22-20(24)12-15-7-8-16(25-3)13-18(15)26-4/h5-9,11,13H,1,10,12H2,2-4H3/b22-21- |
| InChIKey | VVZJJWUXZNERRF-DQRAZIAOSA-N |
| XLogP | 3.88 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|