C20H19BrN2O2S — CID 16848371
N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxy-3-methylphenyl)acetamide (PubChem CID 16848371) has the molecular formula C20H19BrN2O2S and a molecular weight of 431.36 g/mol. Its IUPAC name is N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxy-3-methylphenyl)acetamide.
| Compound Name | N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxy-3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16848371 |
| Molecular Formula | C20H19BrN2O2S |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxy-3-methylphenyl)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2ccc(OC)c(C)c2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C20H19BrN2O2S/c1-4-9-23-16-7-6-15(21)12-18(16)26-20(23)22-19(24)11-14-5-8-17(25-3)13(2)10-14/h4-8,10,12H,1,9,11H2,2-3H3/b22-20- |
| InChIKey | JNWPGEGVVAOCRQ-XDOYNYLZSA-N |
| XLogP | 4.64 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|